Difference between revisions of "Linoleoyl-groups"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite NMNH == * common-name: ** reduced β-nicotinamide d-ribonucleotide * molecular-weight: ** 334.222 * inchi-key: ** xqhmusrslnrvga-turq...")
(Created page with "Category:metabolite == Metabolite BIOTIN == * common-name: ** biotin * molecular-weight: ** 243.3 * inchi-key: ** ybjhbahktgyvgt-zkwxmuahsa-m * smiles: ** c1(s[ch](ccccc(=...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite NMNH ==
+
== Metabolite BIOTIN ==
 
* common-name:
 
* common-name:
** reduced β-nicotinamide d-ribonucleotide
+
** biotin
 
* molecular-weight:
 
* molecular-weight:
** 334.222
+
** 243.3
 
* inchi-key:
 
* inchi-key:
** xqhmusrslnrvga-turqnecasa-l
+
** ybjhbahktgyvgt-zkwxmuahsa-m
 
* smiles:
 
* smiles:
** c1(=c(cc=cn1c2(oc(cop(=o)([o-])[o-])c(o)c(o)2))c(n)=o)
+
** c1(s[ch](ccccc(=o)[o-])[ch]2(nc(=o)n[ch]12))
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[BIOTINLIG-RXN]]
 +
* [[ExchangeSeed-BIOTIN]]
 +
* [[RXN0-7192]]
 +
* [[TransportSeed-BIOTIN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN0-4401]]
+
* [[2.8.1.6-RXN]]
 +
* [[ExchangeSeed-BIOTIN]]
 +
* [[RXN-17473]]
 +
* [[TransportSeed-BIOTIN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=reduced β-nicotinamide d-ribonucleotide}}
+
{{#set: common-name=biotin}}
{{#set: molecular-weight=334.222}}
+
{{#set: molecular-weight=243.3}}
{{#set: inchi-key=inchikey=xqhmusrslnrvga-turqnecasa-l}}
+
{{#set: inchi-key=inchikey=ybjhbahktgyvgt-zkwxmuahsa-m}}

Revision as of 19:02, 17 March 2021

Metabolite BIOTIN

  • common-name:
    • biotin
  • molecular-weight:
    • 243.3
  • inchi-key:
    • ybjhbahktgyvgt-zkwxmuahsa-m
  • smiles:
    • c1(s[ch](ccccc(=o)[o-])[ch]2(nc(=o)n[ch]12))

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality