Difference between revisions of "Beta-Lactams"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite DTDP-DEOH-DEOXY-GLUCOSE == * common-name: ** dtdp-4-dehydro-6-deoxy-α-d-glucopyranose * molecular-weight: ** 544.302 * inchi-key: *...")
(Created page with "Category:metabolite == Metabolite Beta-D-Mannosides == * common-name: ** a β-d-mannoside == Reaction(s) known to consume the compound == * 3.2.1.25-RXN == Reactio...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite DTDP-DEOH-DEOXY-GLUCOSE ==
+
== Metabolite Beta-D-Mannosides ==
 
* common-name:
 
* common-name:
** dtdp-4-dehydro-6-deoxy-α-d-glucopyranose
+
** a β-d-mannoside
* molecular-weight:
 
** 544.302
 
* inchi-key:
 
** psxwnitxwwecny-ucbtuhgzsa-l
 
* smiles:
 
** cc1(=cn(c(=o)nc(=o)1)c3(cc(o)c(cop(=o)([o-])op(=o)([o-])oc2(oc(c)c(=o)c(o)c(o)2))o3))
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[DTDPDEHYDRHAMEPIM-RXN]]
+
* [[3.2.1.25-RXN]]
* [[DTDPRHAMSYNTHMULTI-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[DTDPGLUCDEHYDRAT-RXN]]
 
* [[DTDPRHAMSYNTHMULTI-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=dtdp-4-dehydro-6-deoxy-α-d-glucopyranose}}
+
{{#set: common-name=a β-d-mannoside}}
{{#set: molecular-weight=544.302}}
 
{{#set: inchi-key=inchikey=psxwnitxwwecny-ucbtuhgzsa-l}}
 

Revision as of 19:02, 17 March 2021

Metabolite Beta-D-Mannosides

  • common-name:
    • a β-d-mannoside

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality