Difference between revisions of "ZYMOSTEROL"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite A-LIPID-HYDROPEROXIDE == * common-name: ** a hydroperoxy-fatty-acyl-[lipid] == Reaction(s) known to consume the compound == * 1.11.1.12...") |
(Created page with "Category:metabolite == Metabolite CPD-5821 == * common-name: ** (s)-2-oxo-4-hydroxy-4-carboxy-5-ureidoimidazoline * molecular-weight: ** 201.118 * inchi-key: ** whkyncpixm...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-5821 == |
* common-name: | * common-name: | ||
| − | ** | + | ** (s)-2-oxo-4-hydroxy-4-carboxy-5-ureidoimidazoline |
| + | * molecular-weight: | ||
| + | ** 201.118 | ||
| + | * inchi-key: | ||
| + | ** whkyncpixmntrq-yfkpbyrvsa-m | ||
| + | * smiles: | ||
| + | ** c(c1(o)(nc(=o)n=c1nc(n)=o))(=o)[o-] | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-6201]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[3.5.2.17-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(s)-2-oxo-4-hydroxy-4-carboxy-5-ureidoimidazoline}} |
| + | {{#set: molecular-weight=201.118}} | ||
| + | {{#set: inchi-key=inchikey=whkyncpixmntrq-yfkpbyrvsa-m}} | ||
Revision as of 19:02, 17 March 2021
Contents
Metabolite CPD-5821
- common-name:
- (s)-2-oxo-4-hydroxy-4-carboxy-5-ureidoimidazoline
- molecular-weight:
- 201.118
- inchi-key:
- whkyncpixmntrq-yfkpbyrvsa-m
- smiles:
- c(c1(o)(nc(=o)n=c1nc(n)=o))(=o)[o-]
