Difference between revisions of "CPD-16758"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite D-glucopyranose-6-phosphate == * common-name: ** d-glucopyranose 6-phosphate == Reaction(s) known to consume the compound == * GLU6PDEH...") |
(Created page with "Category:metabolite == Metabolite CPD-16954 == * common-name: ** [1-(2-amino-7-methyl-4-oxo-7,8-dihydro-3h-pteridin-6-yl)]ethyl diphosphate * molecular-weight: ** 380.17 *...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-16954 == |
* common-name: | * common-name: | ||
| − | ** | + | ** [1-(2-amino-7-methyl-4-oxo-7,8-dihydro-3h-pteridin-6-yl)]ethyl diphosphate |
| + | * molecular-weight: | ||
| + | ** 380.17 | ||
| + | * inchi-key: | ||
| + | ** pjdxuyncnwfpcz-iuyqgcfvsa-k | ||
| + | * smiles: | ||
| + | ** cc2(c(c(c)op(=o)([o-])op(=o)([o-])[o-])=nc1(c(=o)nc(n)=nc=1n2)) | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | + | * [[RXN-15733]] | |
| − | |||
| − | |||
| − | * [[RXN- | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=[1-(2-amino-7-methyl-4-oxo-7,8-dihydro-3h-pteridin-6-yl)]ethyl diphosphate}} |
| + | {{#set: molecular-weight=380.17}} | ||
| + | {{#set: inchi-key=inchikey=pjdxuyncnwfpcz-iuyqgcfvsa-k}} | ||
Revision as of 19:02, 17 March 2021
Contents
Metabolite CPD-16954
- common-name:
- [1-(2-amino-7-methyl-4-oxo-7,8-dihydro-3h-pteridin-6-yl)]ethyl diphosphate
- molecular-weight:
- 380.17
- inchi-key:
- pjdxuyncnwfpcz-iuyqgcfvsa-k
- smiles:
- cc2(c(c(c)op(=o)([o-])op(=o)([o-])[o-])=nc1(c(=o)nc(n)=nc=1n2))
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "1-(2-amino-7-methyl-4-oxo-7,8-dihydro-3h-pteridin-6-yl)]ethyl diphosphate" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
