Difference between revisions of "S-Substituted-Glutathione"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15365 == * common-name: ** densipoloyl-coa * molecular-weight: ** 1041.936 * inchi-key: ** qebzgoipmjeisg-apevuuacsa-j * smiles: ** c...")
(Created page with "Category:metabolite == Metabolite HOMO-CIS-ACONITATE == * common_name: ** cis-homoaconitate * smiles: ** c(=o)([o-])c=c(ccc([o-])=o)c(=o)[o-] * inchi_key: ** inchikey=bjyp...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-15365 ==
+
== Metabolite HOMO-CIS-ACONITATE ==
* common-name:
+
* common_name:
** densipoloyl-coa
+
** cis-homoaconitate
* molecular-weight:
 
** 1041.936
 
* inchi-key:
 
** qebzgoipmjeisg-apevuuacsa-j
 
 
* smiles:
 
* smiles:
** ccc=cccc(o)cc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** c(=o)([o-])c=c(ccc([o-])=o)c(=o)[o-]
 +
* inchi_key:
 +
** inchikey=bjypzfuwwjsakc-arjawskdsa-k
 +
* molecular_weight:
 +
** 185.113   
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16150]]
+
* [[HOMOACONITATE-HYDRATASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16150]]
+
* [[RXN3O-1983]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=densipoloyl-coa}}
+
{{#set: common_name=cis-homoaconitate}}
{{#set: molecular-weight=1041.936}}
+
{{#set: inchi_key=inchikey=bjypzfuwwjsakc-arjawskdsa-k}}
{{#set: inchi-key=inchikey=qebzgoipmjeisg-apevuuacsa-j}}
+
{{#set: molecular_weight=185.113    }}

Revision as of 19:02, 17 March 2021

Metabolite HOMO-CIS-ACONITATE

  • common_name:
    • cis-homoaconitate
  • smiles:
    • c(=o)([o-])c=c(ccc([o-])=o)c(=o)[o-]
  • inchi_key:
    • inchikey=bjypzfuwwjsakc-arjawskdsa-k
  • molecular_weight:
    • 185.113

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality