Difference between revisions of "3-OXO-EICOSAPENTAENOYL-ACP"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-1084 == * common-name: ** perillyl aldehyde == Reaction(s) known to consume the compound == * RXN-14280 == Reaction(s) known to p...") |
(Created page with "Category:metabolite == Metabolite T2-DECENOYL-COA == * common-name: ** (2e)-dec-2-enoyl-coa * molecular-weight: ** 915.738 * inchi-key: ** mgnbgcrqqfmnbm-yjhhllfwsa-j * sm...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite T2-DECENOYL-COA == |
* common-name: | * common-name: | ||
− | ** | + | ** (2e)-dec-2-enoyl-coa |
+ | * molecular-weight: | ||
+ | ** 915.738 | ||
+ | * inchi-key: | ||
+ | ** mgnbgcrqqfmnbm-yjhhllfwsa-j | ||
+ | * smiles: | ||
+ | ** cccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-13616]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[DIENOYLCOAREDUCT-RXN]] | ||
+ | * [[RXN-13615]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=(2e)-dec-2-enoyl-coa}} |
+ | {{#set: molecular-weight=915.738}} | ||
+ | {{#set: inchi-key=inchikey=mgnbgcrqqfmnbm-yjhhllfwsa-j}} |
Revision as of 19:02, 17 March 2021
Contents
Metabolite T2-DECENOYL-COA
- common-name:
- (2e)-dec-2-enoyl-coa
- molecular-weight:
- 915.738
- inchi-key:
- mgnbgcrqqfmnbm-yjhhllfwsa-j
- smiles:
- cccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]