Difference between revisions of "TRP-tRNAs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11602 == * common-name: ** ergosterol 3-o-β-d-glucoside * molecular-weight: ** 558.797 * inchi-key: ** mkzpngbjjjzjmi-vnwfyegesa...") |
(Created page with "Category:metabolite == Metabolite CPD-12905 == * common-name: ** 3-hydroxy-5-methylhex-4-enoyl-coa * molecular-weight: ** 889.657 * inchi-key: ** olzynlskrkfujc-fpviqycmsa...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite CPD- | + | == Metabolite CPD-12905 == |
* common-name: | * common-name: | ||
− | ** | + | ** 3-hydroxy-5-methylhex-4-enoyl-coa |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 889.657 |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** olzynlskrkfujc-fpviqycmsa-j |
* smiles: | * smiles: | ||
− | ** cc(c)c(c) | + | ** cc(c)=cc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-11919]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=3-hydroxy-5-methylhex-4-enoyl-coa}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=889.657}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=olzynlskrkfujc-fpviqycmsa-j}} |
Revision as of 19:02, 17 March 2021
Contents
Metabolite CPD-12905
- common-name:
- 3-hydroxy-5-methylhex-4-enoyl-coa
- molecular-weight:
- 889.657
- inchi-key:
- olzynlskrkfujc-fpviqycmsa-j
- smiles:
- cc(c)=cc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]