Difference between revisions of "DNA-containing-abasic-Sites"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite ARG == * common-name: ** l-arginine * molecular-weight: ** 175.21 * inchi-key: ** odksfydxxfifqn-bypyzucnsa-o * smiles: ** c(nc(n)=[n+])c...")
(Created page with "Category:metabolite == Metabolite CPD-11602 == * common-name: ** ergosterol 3-o-β-d-glucoside * molecular-weight: ** 558.797 * inchi-key: ** mkzpngbjjjzjmi-vnwfyegesa...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite ARG ==
+
== Metabolite CPD-11602 ==
 
* common-name:
 
* common-name:
** l-arginine
+
** ergosterol 3-o-β-d-glucoside
 
* molecular-weight:
 
* molecular-weight:
** 175.21
+
** 558.797
 
* inchi-key:
 
* inchi-key:
** odksfydxxfifqn-bypyzucnsa-o
+
** mkzpngbjjjzjmi-vnwfyegesa-n
 
* smiles:
 
* smiles:
** c(nc(n)=[n+])ccc([n+])c(=o)[o-]
+
** cc(c)c(c)c=cc(c)[ch]4(cc[ch]5(c3(=cc=c2(cc(oc1(oc(co)c(o)c(o)c(o)1))ccc(c)2[ch]3ccc(c)45))))
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ARG-OXIDATION-RXN]]
 
* [[ARGDECARBOX-RXN]]
 
* [[ARGINASE-RXN]]
 
* [[ARGININE--TRNA-LIGASE-RXN]]
 
* [[ARGSUCCINLYA-RXN]]
 
* [[biomass_rxn]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ARGDECARBOX-RXN]]
+
* [[RXN-16975]]
* [[ARGINASE-RXN]]
 
* [[ARGSUCCINLYA-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=l-arginine}}
+
{{#set: common-name=ergosterol 3-o-β-d-glucoside}}
{{#set: molecular-weight=175.21}}
+
{{#set: molecular-weight=558.797}}
{{#set: inchi-key=inchikey=odksfydxxfifqn-bypyzucnsa-o}}
+
{{#set: inchi-key=inchikey=mkzpngbjjjzjmi-vnwfyegesa-n}}

Revision as of 19:02, 17 March 2021

Metabolite CPD-11602

  • common-name:
    • ergosterol 3-o-β-d-glucoside
  • molecular-weight:
    • 558.797
  • inchi-key:
    • mkzpngbjjjzjmi-vnwfyegesa-n
  • smiles:
    • cc(c)c(c)c=cc(c)[ch]4(cc[ch]5(c3(=cc=c2(cc(oc1(oc(co)c(o)c(o)c(o)1))ccc(c)2[ch]3ccc(c)45))))

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality