Difference between revisions of "PLASTOQUINONE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-4441 == * common-name: ** cis-zeatin * molecular-weight: ** 219.246 * inchi-key: ** uzkqtcbamswpjd-uqcoibpssa-n * smiles: ** cc(co)=c...")
(Created page with "Category:metabolite == Metabolite ISOCHORISMATE == * common-name: ** isochorismate * molecular-weight: ** 224.17 * inchi-key: ** ntgwprccoqcmge-yumqzzprsa-l * smiles: ** c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-4441 ==
+
== Metabolite ISOCHORISMATE ==
 
* common-name:
 
* common-name:
** cis-zeatin
+
** isochorismate
 
* molecular-weight:
 
* molecular-weight:
** 219.246
+
** 224.17
 
* inchi-key:
 
* inchi-key:
** uzkqtcbamswpjd-uqcoibpssa-n
+
** ntgwprccoqcmge-yumqzzprsa-l
 
* smiles:
 
* smiles:
** cc(co)=ccnc2(c1(=c(nc=n1)n=cn=2))
+
** c=c(c(=o)[o-])oc1(c=cc=c(c1o)c([o-])=o)
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-4733]]
+
* [[2.5.1.64-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=cis-zeatin}}
+
{{#set: common-name=isochorismate}}
{{#set: molecular-weight=219.246}}
+
{{#set: molecular-weight=224.17}}
{{#set: inchi-key=inchikey=uzkqtcbamswpjd-uqcoibpssa-n}}
+
{{#set: inchi-key=inchikey=ntgwprccoqcmge-yumqzzprsa-l}}

Revision as of 19:03, 17 March 2021

Metabolite ISOCHORISMATE

  • common-name:
    • isochorismate
  • molecular-weight:
    • 224.17
  • inchi-key:
    • ntgwprccoqcmge-yumqzzprsa-l
  • smiles:
    • c=c(c(=o)[o-])oc1(c=cc=c(c1o)c([o-])=o)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality