Difference between revisions of "PLASTOQUINONE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-4441 == * common-name: ** cis-zeatin * molecular-weight: ** 219.246 * inchi-key: ** uzkqtcbamswpjd-uqcoibpssa-n * smiles: ** cc(co)=c...") |
(Created page with "Category:metabolite == Metabolite ISOCHORISMATE == * common-name: ** isochorismate * molecular-weight: ** 224.17 * inchi-key: ** ntgwprccoqcmge-yumqzzprsa-l * smiles: ** c...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite ISOCHORISMATE == |
* common-name: | * common-name: | ||
− | ** | + | ** isochorismate |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 224.17 |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** ntgwprccoqcmge-yumqzzprsa-l |
* smiles: | * smiles: | ||
− | ** | + | ** c=c(c(=o)[o-])oc1(c=cc=c(c1o)c([o-])=o) |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN | + | * [[2.5.1.64-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=isochorismate}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=224.17}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ntgwprccoqcmge-yumqzzprsa-l}} |
Revision as of 19:03, 17 March 2021
Contents
Metabolite ISOCHORISMATE
- common-name:
- isochorismate
- molecular-weight:
- 224.17
- inchi-key:
- ntgwprccoqcmge-yumqzzprsa-l
- smiles:
- c=c(c(=o)[o-])oc1(c=cc=c(c1o)c([o-])=o)