Difference between revisions of "S-CD-S-SP-Complex"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite MYRICETIN == * common-name: ** myricetin * molecular-weight: ** 317.231 * inchi-key: ** ikmdfbphznjcsn-uhfffaoysa-m * smiles: ** c1(c(o)=...")
(Created page with "Category:metabolite == Metabolite SULFATE == * common-name: ** sulfate * molecular-weight: ** 96.058 * inchi-key: ** qaowncqodcnurd-uhfffaoysa-l * smiles: ** o=s(=o)([o-])...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite MYRICETIN ==
+
== Metabolite SULFATE ==
 
* common-name:
 
* common-name:
−
** myricetin
+
** sulfate
 
* molecular-weight:
 
* molecular-weight:
−
** 317.231
+
** 96.058
 
* inchi-key:
 
* inchi-key:
−
** ikmdfbphznjcsn-uhfffaoysa-m
+
** qaowncqodcnurd-uhfffaoysa-l
 
* smiles:
 
* smiles:
−
** c1(c(o)=c(o)c(o)=cc=1c2(oc3(c=c(o)c=c(o)c(c(=o)c([o-])=2)=3)))
+
** o=s(=o)([o-])[o-]
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[ExchangeSeed-SULFATE]]
 +
* [[FESO3OXI-RXN]]
 +
* [[SULFATE-ADENYLYLTRANS-RXN]]
 +
* [[TransportSeed-SULFATE]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN-8450]]
+
* [[3.1.6.12-RXN]]
 +
* [[ADENYLYLSULFATASE-RXN]]
 +
* [[ARYLSULFAT-RXN]]
 +
* [[ExchangeSeed-SULFATE]]
 +
* [[FESO3OXI-RXN]]
 +
* [[SULFATE-ADENYLYLTRANS-RXN]]
 +
* [[SULFITE-OXIDASE-RXN]]
 +
* [[TransportSeed-SULFATE]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=myricetin}}
+
{{#set: common-name=sulfate}}
−
{{#set: molecular-weight=317.231}}
+
{{#set: molecular-weight=96.058}}
−
{{#set: inchi-key=inchikey=ikmdfbphznjcsn-uhfffaoysa-m}}
+
{{#set: inchi-key=inchikey=qaowncqodcnurd-uhfffaoysa-l}}

Revision as of 19:03, 17 March 2021

Metabolite SULFATE

  • common-name:
    • sulfate
  • molecular-weight:
    • 96.058
  • inchi-key:
    • qaowncqodcnurd-uhfffaoysa-l
  • smiles:
    • o=s(=o)([o-])[o-]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "http://gem-aureme.genouest.org//esubgem/index.php?title=S-CD-S-SP-Complex&oldid=39423"