Difference between revisions of "MYO-INOSITOL"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD0-1028 == * common-name: ** 2-cis,6-trans,10-trans-geranylgeranyl diphosphate * molecular-weight: ** 447.424 * inchi-key: ** oinneunvo...")
(Created page with "Category:metabolite == Metabolite 7Z-hexadec-7-enoyl-ACPs == * common-name: ** a (7z)-hexadec-7-enoyl-[acp] == Reaction(s) known to consume the compound == * RXN-16625...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD0-1028 ==
+
== Metabolite 7Z-hexadec-7-enoyl-ACPs ==
 
* common-name:
 
* common-name:
** 2-cis,6-trans,10-trans-geranylgeranyl diphosphate
+
** a (7z)-hexadec-7-enoyl-[acp]
* molecular-weight:
 
** 447.424
 
* inchi-key:
 
** oinneunvozhbox-kwbdajkesa-k
 
* smiles:
 
** cc(=cccc(c)=cccc(c)=cccc(c)=ccop([o-])(=o)op(=o)([o-])[o-])c
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-16625]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN0-5180]]
+
* [[RXN-16624]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-cis,6-trans,10-trans-geranylgeranyl diphosphate}}
+
{{#set: common-name=a (7z)-hexadec-7-enoyl-[acp]}}
{{#set: molecular-weight=447.424}}
 
{{#set: inchi-key=inchikey=oinneunvozhbox-kwbdajkesa-k}}
 

Revision as of 19:03, 17 March 2021

Metabolite 7Z-hexadec-7-enoyl-ACPs

  • common-name:
    • a (7z)-hexadec-7-enoyl-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a (7z)-hexadec-7-enoyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.