Difference between revisions of "Charged-HIS-tRNAs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-10353 == * common-name: ** (r)-acetoin * molecular-weight: ** 88.106 * inchi-key: ** rowkjavdogwpat-gsvougtgsa-n * smiles: ** cc(o)c(...") |
(Created page with "Category:metabolite == Metabolite L-ARGININO-SUCCINATE == * common-name: ** l-arginino-succinate * molecular-weight: ** 289.267 * inchi-key: ** kdzoasgqnopscu-zbhicjrosa-m...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite L-ARGININO-SUCCINATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** l-arginino-succinate |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 289.267 |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** kdzoasgqnopscu-zbhicjrosa-m |
* smiles: | * smiles: | ||
| − | ** cc(o)c(=o)c | + | ** c(nc(=[n+])nc(cc(=o)[o-])c(=o)[o-])ccc(c(=o)[o-])[n+] |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[ARGSUCCINLYA-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[ARGSUCCINLYA-RXN]] |
| + | * [[ARGSUCCINSYN-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=l-arginino-succinate}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=289.267}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=kdzoasgqnopscu-zbhicjrosa-m}} |
Revision as of 19:03, 17 March 2021
Contents
Metabolite L-ARGININO-SUCCINATE
- common-name:
- l-arginino-succinate
- molecular-weight:
- 289.267
- inchi-key:
- kdzoasgqnopscu-zbhicjrosa-m
- smiles:
- c(nc(=[n+])nc(cc(=o)[o-])c(=o)[o-])ccc(c(=o)[o-])[n+]
