Difference between revisions of "M7G5-pppR-mRNAs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite ALL-TRANS-HEPTAPRENYL-DIPHOSPHATE == * common-name: ** all-trans-heptaprenyl diphosphate * molecular-weight: ** 651.779 * inchi-key: ** l...")
(Created page with "Category:metabolite == Metabolite Charged-ASP-tRNAs == * common-name: ** an l-aspartyl-[trnaasp] == Reaction(s) known to consume the compound == == Reaction(s) known to pr...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite ALL-TRANS-HEPTAPRENYL-DIPHOSPHATE ==
+
== Metabolite Charged-ASP-tRNAs ==
 
* common-name:
 
* common-name:
** all-trans-heptaprenyl diphosphate
+
** an l-aspartyl-[trnaasp]
* molecular-weight:
 
** 651.779
 
* inchi-key:
 
** lsjlexwxrktzaj-yuiipxgzsa-k
 
* smiles:
 
** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop(=o)([o-])op(=o)([o-])[o-]
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-9222]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[ASPARTATE--TRNA-LIGASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=all-trans-heptaprenyl diphosphate}}
+
{{#set: common-name=an l-aspartyl-[trnaasp]}}
{{#set: molecular-weight=651.779}}
 
{{#set: inchi-key=inchikey=lsjlexwxrktzaj-yuiipxgzsa-k}}
 

Revision as of 19:03, 17 March 2021

Metabolite Charged-ASP-tRNAs

  • common-name:
    • an l-aspartyl-[trnaasp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an l-aspartyl-[trnaasp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.