Difference between revisions of "Chap-ADP-apo-SP-Complex"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite DTDP-D-GLUCOSE == * common-name: ** dtdp-α-d-glucose * molecular-weight: ** 562.317 * inchi-key: ** ysykrgrsmltjnl-urarbognsa-l * s...")
(Created page with "Category:metabolite == Metabolite DITP == * common-name: ** ditp * molecular-weight: ** 488.137 * inchi-key: ** ufjpaqslhagebl-rrkcrqdmsa-j * smiles: ** c(op(=o)([o-])op(=...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite DTDP-D-GLUCOSE ==
+
== Metabolite DITP ==
 
* common-name:
 
* common-name:
** dtdp-α-d-glucose
+
** ditp
 
* molecular-weight:
 
* molecular-weight:
** 562.317
+
** 488.137
 
* inchi-key:
 
* inchi-key:
** ysykrgrsmltjnl-urarbognsa-l
+
** ufjpaqslhagebl-rrkcrqdmsa-j
 
* smiles:
 
* smiles:
** cc1(=cn(c(=o)nc(=o)1)c3(cc(o)c(cop(=o)([o-])op(=o)([o-])oc2(oc(co)c(o)c(o)c(o)2))o3))
+
** c(op(=o)([o-])op(=o)([o-])op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c=nc2(c(=o)nc=nc=23)))
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[DTDPGLUCDEHYDRAT-RXN]]
+
* [[RXN-14228]]
 +
* [[RXN0-1602]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-14228]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=dtdp-α-d-glucose}}
+
{{#set: common-name=ditp}}
{{#set: molecular-weight=562.317}}
+
{{#set: molecular-weight=488.137}}
{{#set: inchi-key=inchikey=ysykrgrsmltjnl-urarbognsa-l}}
+
{{#set: inchi-key=inchikey=ufjpaqslhagebl-rrkcrqdmsa-j}}

Revision as of 19:03, 17 March 2021

Metabolite DITP

  • common-name:
    • ditp
  • molecular-weight:
    • 488.137
  • inchi-key:
    • ufjpaqslhagebl-rrkcrqdmsa-j
  • smiles:
    • c(op(=o)([o-])op(=o)([o-])op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c=nc2(c(=o)nc=nc=23)))

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality