Difference between revisions of "Very-long-chain-fatty-acids"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 3-OXOPALMITOYL-COA == * common-name: ** 3-oxo-palmitoyl-coa * molecular-weight: ** 1015.898 * inchi-key: ** nqmplxpcrjoshl-bbecnahfsa-j *...") |
(Created page with "Category:metabolite == Metabolite CPD-11444 == * common-name: ** uroporphyrinogen-i * molecular-weight: ** 828.742 * inchi-key: ** qttnoskslatgqb-uhfffaoysa-f * smiles: **...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-11444 == |
* common-name: | * common-name: | ||
− | ** | + | ** uroporphyrinogen-i |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 828.742 |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** qttnoskslatgqb-uhfffaoysa-f |
* smiles: | * smiles: | ||
− | ** | + | ** c(=o)([o-])ccc5(=c4(nc(cc1(nc(=c(cc([o-])=o)c(ccc(=o)[o-])=1)cc2(nc(=c(c(ccc(=o)[o-])=2)cc(=o)[o-])cc3(=c(ccc([o-])=o)c(cc(=o)[o-])=c(n3)c4))))=c(cc(=o)[o-])5)) |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | + | * [[RXN-10642]] | |
− | * [[RXN- | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-14396]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=uroporphyrinogen-i}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=828.742}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=qttnoskslatgqb-uhfffaoysa-f}} |
Revision as of 19:03, 17 March 2021
Contents
Metabolite CPD-11444
- common-name:
- uroporphyrinogen-i
- molecular-weight:
- 828.742
- inchi-key:
- qttnoskslatgqb-uhfffaoysa-f
- smiles:
- c(=o)([o-])ccc5(=c4(nc(cc1(nc(=c(cc([o-])=o)c(ccc(=o)[o-])=1)cc2(nc(=c(c(ccc(=o)[o-])=2)cc(=o)[o-])cc3(=c(ccc([o-])=o)c(cc(=o)[o-])=c(n3)c4))))=c(cc(=o)[o-])5))