Difference between revisions of "Very-long-chain-fatty-acids"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 3-OXOPALMITOYL-COA == * common-name: ** 3-oxo-palmitoyl-coa * molecular-weight: ** 1015.898 * inchi-key: ** nqmplxpcrjoshl-bbecnahfsa-j *...")
(Created page with "Category:metabolite == Metabolite CPD-11444 == * common-name: ** uroporphyrinogen-i * molecular-weight: ** 828.742 * inchi-key: ** qttnoskslatgqb-uhfffaoysa-f * smiles: **...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 3-OXOPALMITOYL-COA ==
+
== Metabolite CPD-11444 ==
 
* common-name:
 
* common-name:
** 3-oxo-palmitoyl-coa
+
** uroporphyrinogen-i
 
* molecular-weight:
 
* molecular-weight:
** 1015.898
+
** 828.742
 
* inchi-key:
 
* inchi-key:
** nqmplxpcrjoshl-bbecnahfsa-j
+
** qttnoskslatgqb-uhfffaoysa-f
 
* smiles:
 
* smiles:
** cccccccccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** c(=o)([o-])ccc5(=c4(nc(cc1(nc(=c(cc([o-])=o)c(ccc(=o)[o-])=1)cc2(nc(=c(c(ccc(=o)[o-])=2)cc(=o)[o-])cc3(=c(ccc([o-])=o)c(cc(=o)[o-])=c(n3)c4))))=c(cc(=o)[o-])5))
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.3.1.155-RXN]]
+
* [[RXN-10642]]
* [[RXN-14271]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14271]]
+
* [[RXN-14396]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-oxo-palmitoyl-coa}}
+
{{#set: common-name=uroporphyrinogen-i}}
{{#set: molecular-weight=1015.898}}
+
{{#set: molecular-weight=828.742}}
{{#set: inchi-key=inchikey=nqmplxpcrjoshl-bbecnahfsa-j}}
+
{{#set: inchi-key=inchikey=qttnoskslatgqb-uhfffaoysa-f}}

Revision as of 19:03, 17 March 2021

Metabolite CPD-11444

  • common-name:
    • uroporphyrinogen-i
  • molecular-weight:
    • 828.742
  • inchi-key:
    • qttnoskslatgqb-uhfffaoysa-f
  • smiles:
    • c(=o)([o-])ccc5(=c4(nc(cc1(nc(=c(cc([o-])=o)c(ccc(=o)[o-])=1)cc2(nc(=c(c(ccc(=o)[o-])=2)cc(=o)[o-])cc3(=c(ccc([o-])=o)c(cc(=o)[o-])=c(n3)c4))))=c(cc(=o)[o-])5))

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality