Difference between revisions of "Pi"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12443 == * common-name: ** perillate == Reaction(s) known to consume the compound == == Reaction(s) known to produce the compound ==...")
(Created page with "Category:metabolite == Metabolite CPD-18489 == * common-name: ** (3r,9z,12z,15z,18z)-3-hydroxytetracosatetraenoyl-coa * molecular-weight: ** 1122.065 * inchi-key: ** dmysj...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-12443 ==
+
== Metabolite CPD-18489 ==
 
* common-name:
 
* common-name:
** perillate
+
** (3r,9z,12z,15z,18z)-3-hydroxytetracosatetraenoyl-coa
 +
* molecular-weight:
 +
** 1122.065
 +
* inchi-key:
 +
** dmysjgjjptxmaw-jjkiljmssa-j
 +
* smiles:
 +
** cccccc=ccc=ccc=ccc=ccccccc(o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14280]]
+
* [[RXN-17109]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=perillate}}
+
{{#set: common-name=(3r,9z,12z,15z,18z)-3-hydroxytetracosatetraenoyl-coa}}
 +
{{#set: molecular-weight=1122.065}}
 +
{{#set: inchi-key=inchikey=dmysjgjjptxmaw-jjkiljmssa-j}}

Revision as of 19:03, 17 March 2021

Metabolite CPD-18489

  • common-name:
    • (3r,9z,12z,15z,18z)-3-hydroxytetracosatetraenoyl-coa
  • molecular-weight:
    • 1122.065
  • inchi-key:
    • dmysjgjjptxmaw-jjkiljmssa-j
  • smiles:
    • cccccc=ccc=ccc=ccc=ccccccc(o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality