Difference between revisions of "Pi"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12443 == * common-name: ** perillate == Reaction(s) known to consume the compound == == Reaction(s) known to produce the compound ==...") |
(Created page with "Category:metabolite == Metabolite CPD-18489 == * common-name: ** (3r,9z,12z,15z,18z)-3-hydroxytetracosatetraenoyl-coa * molecular-weight: ** 1122.065 * inchi-key: ** dmysj...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite CPD- | + | == Metabolite CPD-18489 == |
* common-name: | * common-name: | ||
− | ** | + | ** (3r,9z,12z,15z,18z)-3-hydroxytetracosatetraenoyl-coa |
+ | * molecular-weight: | ||
+ | ** 1122.065 | ||
+ | * inchi-key: | ||
+ | ** dmysjgjjptxmaw-jjkiljmssa-j | ||
+ | * smiles: | ||
+ | ** cccccc=ccc=ccc=ccc=ccccccc(o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-17109]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=(3r,9z,12z,15z,18z)-3-hydroxytetracosatetraenoyl-coa}} |
+ | {{#set: molecular-weight=1122.065}} | ||
+ | {{#set: inchi-key=inchikey=dmysjgjjptxmaw-jjkiljmssa-j}} |
Revision as of 19:03, 17 March 2021
Contents
Metabolite CPD-18489
- common-name:
- (3r,9z,12z,15z,18z)-3-hydroxytetracosatetraenoyl-coa
- molecular-weight:
- 1122.065
- inchi-key:
- dmysjgjjptxmaw-jjkiljmssa-j
- smiles:
- cccccc=ccc=ccc=ccc=ccccccc(o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o