Difference between revisions of "DIHYDROXYACETONE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Oxidized-ferredoxins == * common-name: ** an oxidized ferredoxin [iron-sulfur] cluster == Reaction(s) known to consume the compound == *...") |
(Created page with "Category:metabolite == Metabolite N2-ACETYL-ALPHA-AMIN == * common-name: ** n2-acetyl-α-aminoadipate * molecular-weight: ** 201.179 * inchi-key: ** fttgaazkbnzdcz-lu...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite N2-ACETYL-ALPHA-AMIN == |
* common-name: | * common-name: | ||
| − | ** | + | ** n2-acetyl-α-aminoadipate |
| + | * molecular-weight: | ||
| + | ** 201.179 | ||
| + | * inchi-key: | ||
| + | ** fttgaazkbnzdcz-lurjtmiesa-l | ||
| + | * smiles: | ||
| + | ** cc(=o)nc(cccc(=o)[o-])c(=o)[o-] | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | + | * [[RXN-5181]] | |
| − | |||
| − | * [[RXN- | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | + | * [[RXN-5181]] | |
| − | |||
| − | |||
| − | |||
| − | |||
| − | * [[RXN- | ||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=n2-acetyl-α-aminoadipate}} |
| + | {{#set: molecular-weight=201.179}} | ||
| + | {{#set: inchi-key=inchikey=fttgaazkbnzdcz-lurjtmiesa-l}} | ||
Revision as of 19:03, 17 March 2021
Contents
Metabolite N2-ACETYL-ALPHA-AMIN
- common-name:
- n2-acetyl-α-aminoadipate
- molecular-weight:
- 201.179
- inchi-key:
- fttgaazkbnzdcz-lurjtmiesa-l
- smiles:
- cc(=o)nc(cccc(=o)[o-])c(=o)[o-]
