Difference between revisions of "3-P-SERINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD0-2117 == * common-name: ** (2e)-hexadecenoyl-coa * molecular-weight: ** 999.899 * inchi-key: ** jupaqfrkphpxld-mshhsvqmsa-j * smiles:...") |
(Created page with "Category:metabolite == Metabolite CPD-316 == * common-name: ** reduced riboflavin * molecular-weight: ** 378.384 * inchi-key: ** utkdoucgqvljin-pigzvrmjsa-n * smiles: ** c...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-316 == |
* common-name: | * common-name: | ||
− | ** | + | ** reduced riboflavin |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 378.384 |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** utkdoucgqvljin-pigzvrmjsa-n |
* smiles: | * smiles: | ||
− | ** | + | ** cc1(=c(c=c2(c(=c1)nc3(c(n2cc(o)c(o)c(o)co)=nc(nc3=o)=o)))c) |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[NADPH-DEHYDROGENASE-FLAVIN-RXN]] |
+ | * [[RXN-12445]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=reduced riboflavin}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=378.384}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=utkdoucgqvljin-pigzvrmjsa-n}} |
Revision as of 19:03, 17 March 2021
Contents
Metabolite CPD-316
- common-name:
- reduced riboflavin
- molecular-weight:
- 378.384
- inchi-key:
- utkdoucgqvljin-pigzvrmjsa-n
- smiles:
- cc1(=c(c=c2(c(=c1)nc3(c(n2cc(o)c(o)c(o)co)=nc(nc3=o)=o)))c)