Difference between revisions of "CPD-2961"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CARBOXYPHENYLAMINO-DEOXYRIBULOSE-P == * common-name: ** 1-(o-carboxyphenylamino)-1'-deoxyribulose 5'-phosphate * molecular-weight: ** 346...") |
(Created page with "Category:metabolite == Metabolite BETA-D-GALACTOSYL-ETCETERA-GLUCOSAMINE == * common_name: ** β-d-galactosyl-1,4-n-acetyl-β-d-glucosamine * smiles: ** cc(=o)nc2(...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite BETA-D-GALACTOSYL-ETCETERA-GLUCOSAMINE == |
− | * | + | * common_name: |
− | ** | + | ** β-d-galactosyl-1,4-n-acetyl-β-d-glucosamine |
− | |||
− | |||
− | |||
− | |||
* smiles: | * smiles: | ||
− | ** | + | ** cc(=o)nc2(c(o)oc(co)c(oc1(oc(co)c(o)c(o)c(o)1))c(o)2) |
+ | * inchi_key: | ||
+ | ** inchikey=kfeujdwyngmdbv-lodbtcklsa-n | ||
+ | * molecular_weight: | ||
+ | ** 383.352 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-15268]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-15268]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: | + | {{#set: common_name=β-d-galactosyl-1,4-n-acetyl-β-d-glucosamine}} |
− | {{#set: | + | {{#set: inchi_key=inchikey=kfeujdwyngmdbv-lodbtcklsa-n}} |
− | {{#set: | + | {{#set: molecular_weight=383.352 }} |
Revision as of 19:03, 17 March 2021
Contents
Metabolite BETA-D-GALACTOSYL-ETCETERA-GLUCOSAMINE
- common_name:
- β-d-galactosyl-1,4-n-acetyl-β-d-glucosamine
- smiles:
- cc(=o)nc2(c(o)oc(co)c(oc1(oc(co)c(o)c(o)c(o)1))c(o)2)
- inchi_key:
- inchikey=kfeujdwyngmdbv-lodbtcklsa-n
- molecular_weight:
- 383.352