Difference between revisions of "CPD-2961"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CARBOXYPHENYLAMINO-DEOXYRIBULOSE-P == * common-name: ** 1-(o-carboxyphenylamino)-1'-deoxyribulose 5'-phosphate * molecular-weight: ** 346...")
(Created page with "Category:metabolite == Metabolite BETA-D-GALACTOSYL-ETCETERA-GLUCOSAMINE == * common_name: ** β-d-galactosyl-1,4-n-acetyl-β-d-glucosamine * smiles: ** cc(=o)nc2(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CARBOXYPHENYLAMINO-DEOXYRIBULOSE-P ==
+
== Metabolite BETA-D-GALACTOSYL-ETCETERA-GLUCOSAMINE ==
* common-name:
+
* common_name:
** 1-(o-carboxyphenylamino)-1'-deoxyribulose 5'-phosphate
+
** β-d-galactosyl-1,4-n-acetyl-β-d-glucosamine
* molecular-weight:
 
** 346.21
 
* inchi-key:
 
** qkmbynrmprkvto-mnovxskesa-k
 
 
* smiles:
 
* smiles:
** c(op(=o)([o-])[o-])c(o)c(o)c(=o)cnc1(c=cc=cc(c(=o)[o-])=1)
+
** cc(=o)nc2(c(o)oc(co)c(oc1(oc(co)c(o)c(o)c(o)1))c(o)2)
 +
* inchi_key:
 +
** inchikey=kfeujdwyngmdbv-lodbtcklsa-n
 +
* molecular_weight:
 +
** 383.352   
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[IGPSYN-RXN]]
+
* [[RXN-15268]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[PRAISOM-RXN]]
+
* [[RXN-15268]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-(o-carboxyphenylamino)-1'-deoxyribulose 5'-phosphate}}
+
{{#set: common_name=β-d-galactosyl-1,4-n-acetyl-β-d-glucosamine}}
{{#set: molecular-weight=346.21}}
+
{{#set: inchi_key=inchikey=kfeujdwyngmdbv-lodbtcklsa-n}}
{{#set: inchi-key=inchikey=qkmbynrmprkvto-mnovxskesa-k}}
+
{{#set: molecular_weight=383.352    }}

Revision as of 19:03, 17 March 2021

Metabolite BETA-D-GALACTOSYL-ETCETERA-GLUCOSAMINE

  • common_name:
    • β-d-galactosyl-1,4-n-acetyl-β-d-glucosamine
  • smiles:
    • cc(=o)nc2(c(o)oc(co)c(oc1(oc(co)c(o)c(o)c(o)1))c(o)2)
  • inchi_key:
    • inchikey=kfeujdwyngmdbv-lodbtcklsa-n
  • molecular_weight:
    • 383.352

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality