Difference between revisions of "Cytochromes-C-Reduced"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 2-Lysophosphatidylcholines == * common-name: ** a 1-acyl-sn-glycero-3-phosphocholine == Reaction(s) known to consume the compound == * ...")
(Created page with "Category:metabolite == Metabolite CARBOXYPHENYLAMINO-DEOXYRIBULOSE-P == * common-name: ** 1-(o-carboxyphenylamino)-1'-deoxyribulose 5'-phosphate * molecular-weight: ** 346...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 2-Lysophosphatidylcholines ==
+
== Metabolite CARBOXYPHENYLAMINO-DEOXYRIBULOSE-P ==
 
* common-name:
 
* common-name:
** a 1-acyl-sn-glycero-3-phosphocholine
+
** 1-(o-carboxyphenylamino)-1'-deoxyribulose 5'-phosphate
 +
* molecular-weight:
 +
** 346.21
 +
* inchi-key:
 +
** qkmbynrmprkvto-mnovxskesa-k
 +
* smiles:
 +
** c(op(=o)([o-])[o-])c(o)c(o)c(=o)cnc1(c=cc=cc(c(=o)[o-])=1)
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.3.1.23-RXN]]
+
* [[IGPSYN-RXN]]
* [[LYSOPHOSPHOLIPASE-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.3.1.23-RXN]]
+
* [[PRAISOM-RXN]]
* [[RXN-1501_METACYC18.5]]
 
* [[RXN-1641]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a 1-acyl-sn-glycero-3-phosphocholine}}
+
{{#set: common-name=1-(o-carboxyphenylamino)-1'-deoxyribulose 5'-phosphate}}
 +
{{#set: molecular-weight=346.21}}
 +
{{#set: inchi-key=inchikey=qkmbynrmprkvto-mnovxskesa-k}}

Revision as of 19:03, 17 March 2021

Metabolite CARBOXYPHENYLAMINO-DEOXYRIBULOSE-P

  • common-name:
    • 1-(o-carboxyphenylamino)-1'-deoxyribulose 5'-phosphate
  • molecular-weight:
    • 346.21
  • inchi-key:
    • qkmbynrmprkvto-mnovxskesa-k
  • smiles:
    • c(op(=o)([o-])[o-])c(o)c(o)c(=o)cnc1(c=cc=cc(c(=o)[o-])=1)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality