Difference between revisions of "CDP-2-3-4-Saturated-Diacylglycerols"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17045 == * common-name: ** 3-benzyl-3,6-dihydroxy-6-(hydroxymethyl)-diketopiperazine * molecular-weight: ** 266.253 * inchi-key: ** p...")
(Created page with "Category:metabolite == Metabolite CPD-17272 == * common-name: ** 1-oleoyl-2-palmitoyl-glycerol * molecular-weight: ** 594.957 * inchi-key: ** dozkmfvmcatmeh-ozktzcccsa-n *...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-17045 ==
+
== Metabolite CPD-17272 ==
 
* common-name:
 
* common-name:
** 3-benzyl-3,6-dihydroxy-6-(hydroxymethyl)-diketopiperazine
+
** 1-oleoyl-2-palmitoyl-glycerol
 
* molecular-weight:
 
* molecular-weight:
** 266.253
+
** 594.957
 
* inchi-key:
 
* inchi-key:
** pxypzmrmtkvysm-vxgbxaggsa-n
+
** dozkmfvmcatmeh-ozktzcccsa-n
 
* smiles:
 
* smiles:
** c(o)c2(o)(nc(=o)c(o)(cc1(=cc=cc=c1))nc(=o)2)
+
** ccccccccc=ccccccccc(occ(oc(=o)ccccccccccccccc)co)=o
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-15680]]
+
* [[RXN-16027]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-16027]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-benzyl-3,6-dihydroxy-6-(hydroxymethyl)-diketopiperazine}}
+
{{#set: common-name=1-oleoyl-2-palmitoyl-glycerol}}
{{#set: molecular-weight=266.253}}
+
{{#set: molecular-weight=594.957}}
{{#set: inchi-key=inchikey=pxypzmrmtkvysm-vxgbxaggsa-n}}
+
{{#set: inchi-key=inchikey=dozkmfvmcatmeh-ozktzcccsa-n}}

Revision as of 19:03, 17 March 2021

Metabolite CPD-17272

  • common-name:
    • 1-oleoyl-2-palmitoyl-glycerol
  • molecular-weight:
    • 594.957
  • inchi-key:
    • dozkmfvmcatmeh-ozktzcccsa-n
  • smiles:
    • ccccccccc=ccccccccc(occ(oc(=o)ccccccccccccccc)co)=o

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality