Difference between revisions of "CPD-11555"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-674 == * common-name: ** trans-cinnamate * molecular-weight: ** 147.153 * inchi-key: ** wbywaxjhaxsjni-votsokgwsa-m * smiles: ** c(=o...")
(Created page with "Category:metabolite == Metabolite Kinesin-Microtubules-Complex == * common-name: ** a kinesin-microtubules complex == Reaction(s) known to consume the compound == * 3.6....")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-674 ==
+
== Metabolite Kinesin-Microtubules-Complex ==
 
* common-name:
 
* common-name:
** trans-cinnamate
+
** a kinesin-microtubules complex
* molecular-weight:
 
** 147.153
 
* inchi-key:
 
** wbywaxjhaxsjni-votsokgwsa-m
 
* smiles:
 
** c(=o)([o-])c=cc1(=cc=cc=c1)
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-2001]]
+
* [[3.6.4.4-RXN]]
 +
* [[3.6.4.5-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[3.6.4.4-RXN]]
 +
* [[3.6.4.5-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=trans-cinnamate}}
+
{{#set: common-name=a kinesin-microtubules complex}}
{{#set: molecular-weight=147.153}}
 
{{#set: inchi-key=inchikey=wbywaxjhaxsjni-votsokgwsa-m}}
 

Revision as of 19:03, 17 March 2021

Metabolite Kinesin-Microtubules-Complex

  • common-name:
    • a kinesin-microtubules complex

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality