Difference between revisions of "N-Substituted-Amino-Acids"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Charged-PHE-tRNAs == * common-name: ** an l-phenylalanyl-[trnaphe] == Reaction(s) known to consume the compound == == Reaction(s) known t...") |
(Created page with "Category:metabolite == Metabolite PHYTYL-PYROPHOSPHATE == * common-name: ** phytyl diphosphate * molecular-weight: ** 453.471 * inchi-key: ** itplbnccpzsweu-pyddkjgssa-k *...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite PHYTYL-PYROPHOSPHATE == |
* common-name: | * common-name: | ||
− | ** | + | ** phytyl diphosphate |
+ | * molecular-weight: | ||
+ | ** 453.471 | ||
+ | * inchi-key: | ||
+ | ** itplbnccpzsweu-pyddkjgssa-k | ||
+ | * smiles: | ||
+ | ** cc(cccc(cccc(cccc(=ccop([o-])(=o)op([o-])(=o)[o-])c)c)c)c | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-2541]] | ||
+ | * [[RXN-7674]] | ||
+ | * [[RXN1F-66]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-10625]] |
+ | * [[RXN1F-66]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=phytyl diphosphate}} |
+ | {{#set: molecular-weight=453.471}} | ||
+ | {{#set: inchi-key=inchikey=itplbnccpzsweu-pyddkjgssa-k}} |
Revision as of 19:03, 17 March 2021
Contents
Metabolite PHYTYL-PYROPHOSPHATE
- common-name:
- phytyl diphosphate
- molecular-weight:
- 453.471
- inchi-key:
- itplbnccpzsweu-pyddkjgssa-k
- smiles:
- cc(cccc(cccc(cccc(=ccop([o-])(=o)op([o-])(=o)[o-])c)c)c)c