Difference between revisions of "CPD-85"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite GUANOSINE == * common-name: ** guanosine * molecular-weight: ** 283.243 * inchi-key: ** nyhbqmygnkiuif-uuokfmhzsa-n * smiles: ** c(o)c1(o...")
(Created page with "Category:metabolite == Metabolite Charged-THR-tRNAs == * common-name: ** an l-threonyl-[trnathr] == Reaction(s) known to consume the compound == == Reaction(s) known to pr...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite GUANOSINE ==
+
== Metabolite Charged-THR-tRNAs ==
 
* common-name:
 
* common-name:
** guanosine
+
** an l-threonyl-[trnathr]
* molecular-weight:
 
** 283.243
 
* inchi-key:
 
** nyhbqmygnkiuif-uuokfmhzsa-n
 
* smiles:
 
** c(o)c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(n)=nc=23)))
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-7609]]
+
* [[THREONINE--TRNA-LIGASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=guanosine}}
+
{{#set: common-name=an l-threonyl-[trnathr]}}
{{#set: molecular-weight=283.243}}
 
{{#set: inchi-key=inchikey=nyhbqmygnkiuif-uuokfmhzsa-n}}
 

Revision as of 19:03, 17 March 2021

Metabolite Charged-THR-tRNAs

  • common-name:
    • an l-threonyl-[trnathr]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an l-threonyl-[trnathr" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.