Difference between revisions of "L-1-phosphatidyl-inositols"

Revision as of 19:03, 17 March 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite CPD-9864 ==
+== Metabolite L-1-phosphatidyl-inositols ==
 * common-name:
-** 3-decaprenyl-4-hydroxybenzoate
+** a 1-phosphatidyl-1d-myo-inositol
-* molecular-weight:
-** 818.297
-* inchi-key:
-** cmpnjzrebhcphn-ltnibbdrsa-m
-* smiles:
-** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(o)c=cc(c(=o)[o-])=c1))c)c)c)c)c)c)c)c)c)c
 == Reaction(s) known to consume the compound ==
+* [[1-PHOSPHATIDYLINOSITOL-3-KINASE-RXN]]
+* [[1-PHOSPHATIDYLINOSITOL-KINASE-RXN]]
+* [[2.4.1.198-RXN]]
+* [[PHOSPHATIDYLINOSITOL-DEACYLASE-RXN]]
+* [[RXN-16261]]
 == Reaction(s) known to produce the compound ==
-* [[RXN-9230]]
+* [[2.4.1.198-RXN]]
+* [[2.7.8.11-RXN]]
+* [[PHOSPHATIDYLINOSITOL-3-PHOSPHATASE-RXN]]
+* [[RXN-10961]]
+* [[RXN-10962]]
+* [[RXN-16261]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=3-decaprenyl-4-hydroxybenzoate}}
+{{#set: common-name=a 1-phosphatidyl-1d-myo-inositol}}
-{{#set: molecular-weight=818.297}}
-{{#set: inchi-key=inchikey=cmpnjzrebhcphn-ltnibbdrsa-m}}