Difference between revisions of "CPD0-971"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Methylated-MtbC-Proteins == * common-name: ** a [methyl-co(iii) dimethylamine-specific corrinoid protein] == Reaction(s) known to consume...") |
(Created page with "Category:metabolite == Metabolite MALTOTRIOSE == * common-name: ** maltotriose * molecular-weight: ** 504.441 * inchi-key: ** fygdtmlnykfzsv-dzoucchmsa-n * smiles: ** c(c1...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite MALTOTRIOSE == |
* common-name: | * common-name: | ||
| − | ** | + | ** maltotriose |
| + | * molecular-weight: | ||
| + | ** 504.441 | ||
| + | * inchi-key: | ||
| + | ** fygdtmlnykfzsv-dzoucchmsa-n | ||
| + | * smiles: | ||
| + | ** c(c1(oc(c(c(c1o)o)o)oc2(c(oc(c(c2o)o)oc3(c(oc(c(c3o)o)o)co))co)))o | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN0-5182]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=maltotriose}} |
| + | {{#set: molecular-weight=504.441}} | ||
| + | {{#set: inchi-key=inchikey=fygdtmlnykfzsv-dzoucchmsa-n}} | ||
Revision as of 19:03, 17 March 2021
Contents
Metabolite MALTOTRIOSE
- common-name:
- maltotriose
- molecular-weight:
- 504.441
- inchi-key:
- fygdtmlnykfzsv-dzoucchmsa-n
- smiles:
- c(c1(oc(c(c(c1o)o)o)oc2(c(oc(c(c2o)o)oc3(c(oc(c(c3o)o)o)co))co)))o
