Difference between revisions of "CPD0-2354"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite D-THREONINE == * common-name: ** d-threonine * molecular-weight: ** 119.12 * inchi-key: ** ayfvyjqapqtccc-sthayslisa-n * smiles: ** cc(o)...") |
(Created page with "Category:metabolite == Metabolite NONAPRENYL-4-HYDROXYBENZOATE == * common-name: ** 3-nonaprenyl-4-hydroxybenzoate * molecular-weight: ** 750.178 * inchi-key: ** ykkkmrbep...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite NONAPRENYL-4-HYDROXYBENZOATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** 3-nonaprenyl-4-hydroxybenzoate |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 750.178 |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** ykkkmrbepizpbh-xweajcocsa-m |
* smiles: | * smiles: | ||
| − | ** cc(o)c( | + | ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(o)c=cc(c(=o)[o-])=c1))c)c)c)c)c)c)c)c)c |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[2.5.1.39-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=3-nonaprenyl-4-hydroxybenzoate}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=750.178}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ykkkmrbepizpbh-xweajcocsa-m}} |
Revision as of 19:03, 17 March 2021
Contents
Metabolite NONAPRENYL-4-HYDROXYBENZOATE
- common-name:
- 3-nonaprenyl-4-hydroxybenzoate
- molecular-weight:
- 750.178
- inchi-key:
- ykkkmrbepizpbh-xweajcocsa-m
- smiles:
- cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(o)c=cc(c(=o)[o-])=c1))c)c)c)c)c)c)c)c)c
