Difference between revisions of "Alpha-D-Galactosides"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-4186 == * common-name: ** lathosterol * molecular-weight: ** 386.66 * inchi-key: ** izvffxvybhfihy-skcnuyalsa-n * smiles: ** cc(c)ccc...")
(Created page with "Category:metabolite == Metabolite FMN == * common-name: ** fmn * molecular-weight: ** 453.324 * inchi-key: ** ankzybdxhmzbdk-scrdcrapsa-k * smiles: ** cc2(=cc1(n=c3(c(=o)[...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-4186 ==
+
== Metabolite FMN ==
 
* common-name:
 
* common-name:
** lathosterol
+
** fmn
 
* molecular-weight:
 
* molecular-weight:
** 386.66
+
** 453.324
 
* inchi-key:
 
* inchi-key:
** izvffxvybhfihy-skcnuyalsa-n
+
** ankzybdxhmzbdk-scrdcrapsa-k
 
* smiles:
 
* smiles:
** cc(c)cccc([ch]4(c1(c)([ch](c2([ch](cc1)c3(c)([ch](cc=2)cc(o)cc3)))cc4)))c
+
** cc2(=cc1(n=c3(c(=o)[n-]c(=o)n=c(n(cc(o)c(o)c(o)cop([o-])(=o)[o-])c=1c=c(c)2)3)))
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[FADSYN-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN66-25]]
+
* [[RIBOFLAVINKIN-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=lathosterol}}
+
{{#set: common-name=fmn}}
{{#set: molecular-weight=386.66}}
+
{{#set: molecular-weight=453.324}}
{{#set: inchi-key=inchikey=izvffxvybhfihy-skcnuyalsa-n}}
+
{{#set: inchi-key=inchikey=ankzybdxhmzbdk-scrdcrapsa-k}}

Revision as of 19:03, 17 March 2021

Metabolite FMN

  • common-name:
    • fmn
  • molecular-weight:
    • 453.324
  • inchi-key:
    • ankzybdxhmzbdk-scrdcrapsa-k
  • smiles:
    • cc2(=cc1(n=c3(c(=o)[n-]c(=o)n=c(n(cc(o)c(o)c(o)cop([o-])(=o)[o-])c=1c=c(c)2)3)))

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality