Difference between revisions of "ACETOACETYL-COA"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite AGMATHINE == * common-name: ** agmatine * molecular-weight: ** 132.208 * inchi-key: ** qyppjabkjhavhs-uhfffaoysa-p * smiles: ** c(ccc[n+]...") |
(Created page with "Category:metabolite == Metabolite TRP == * common-name: ** l-tryptophan * molecular-weight: ** 204.228 * inchi-key: ** qivbcdijiajpqs-vifpvbqesa-n * smiles: ** c2(nc1(c=cc...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite TRP == |
* common-name: | * common-name: | ||
| − | ** | + | ** l-tryptophan |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 204.228 |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** qivbcdijiajpqs-vifpvbqesa-n |
* smiles: | * smiles: | ||
| − | ** c( | + | ** c2(nc1(c=cc=cc=1c(cc([n+])c(=o)[o-])=2)) |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[AROMATIC-L-AMINO-ACID-DECARBOXYLASE-RXN]] |
| − | * [[ | + | * [[TRYPTOPHAN--TRNA-LIGASE-RXN]] |
| + | * [[biomass_rxn]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN0-2382]] |
| + | * [[TRYPSYN-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=l-tryptophan}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=204.228}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=qivbcdijiajpqs-vifpvbqesa-n}} |
Revision as of 19:03, 17 March 2021
Contents
Metabolite TRP
- common-name:
- l-tryptophan
- molecular-weight:
- 204.228
- inchi-key:
- qivbcdijiajpqs-vifpvbqesa-n
- smiles:
- c2(nc1(c=cc=cc=1c(cc([n+])c(=o)[o-])=2))
