Difference between revisions of "CPD-315"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 2C-METH-D-ERYTHRITOL-CYCLODIPHOSPHATE == * common-name: ** 2-c-methyl-d-erythritol-2,4-cyclodiphosphate * molecular-weight: ** 276.076 *...") |
(Created page with "Category:metabolite == Metabolite GAMMA-LINOLENOYL-COA == * common-name: ** γ-linolenoyl-coa * molecular-weight: ** 1023.921 * inchi-key: ** xzqyptbyqyzgru-fhdveodps...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite GAMMA-LINOLENOYL-COA == |
* common-name: | * common-name: | ||
| − | ** | + | ** γ-linolenoyl-coa |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 1023.921 |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** xzqyptbyqyzgru-fhdveodpsa-j |
* smiles: | * smiles: | ||
| − | ** | + | ** cccccc=ccc=ccc=cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-16043]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=γ-linolenoyl-coa}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=1023.921}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=xzqyptbyqyzgru-fhdveodpsa-j}} |
Revision as of 19:03, 17 March 2021
Contents
Metabolite GAMMA-LINOLENOYL-COA
- common-name:
- γ-linolenoyl-coa
- molecular-weight:
- 1023.921
- inchi-key:
- xzqyptbyqyzgru-fhdveodpsa-j
- smiles:
- cccccc=ccc=ccc=cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
