Difference between revisions of "Protein-N-terminal-L-Arginine"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 3-oxo-cerotoyl-ACPs == * common-name: ** a 3-oxohexacosanoyl-[acp] == Reaction(s) known to consume the compound == * RXN-10060 == Rea...") |
(Created page with "Category:metabolite == Metabolite UDP-D-XYLOSE == * common-name: ** udp-α-d-xylose * molecular-weight: ** 534.263 * inchi-key: ** dqqdlyvhotzlor-ocimbmbzsa-l * smile...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite UDP-D-XYLOSE == |
* common-name: | * common-name: | ||
| − | ** | + | ** udp-α-d-xylose |
| + | * molecular-weight: | ||
| + | ** 534.263 | ||
| + | * inchi-key: | ||
| + | ** dqqdlyvhotzlor-ocimbmbzsa-l | ||
| + | * smiles: | ||
| + | ** c3(oc(op(=o)([o-])op(=o)([o-])occ1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)))c(o)c(o)c(o)3) | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[2.4.2.26-RXN]] |
| + | * [[2.7.7.11-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[2.7.7.11-RXN]] |
| + | * [[UDP-GLUCURONATE-DECARBOXYLASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=udp-α-d-xylose}} |
| + | {{#set: molecular-weight=534.263}} | ||
| + | {{#set: inchi-key=inchikey=dqqdlyvhotzlor-ocimbmbzsa-l}} | ||
Revision as of 19:04, 17 March 2021
Contents
Metabolite UDP-D-XYLOSE
- common-name:
- udp-α-d-xylose
- molecular-weight:
- 534.263
- inchi-key:
- dqqdlyvhotzlor-ocimbmbzsa-l
- smiles:
- c3(oc(op(=o)([o-])op(=o)([o-])occ1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)))c(o)c(o)c(o)3)
