Difference between revisions of "CPD-707"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite THIAMINE-PYROPHOSPHATE == * common-name: ** thiamine diphosphate * molecular-weight: ** 422.288 * inchi-key: ** ayekofbpnlcajy-uhfffaoysa...")
(Created page with "Category:metabolite == Metabolite All-trans-Retinyl-Esters == * common-name: ** an all-trans-retinyl ester == Reaction(s) known to consume the compound == * RXN-12575...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite THIAMINE-PYROPHOSPHATE ==
+
== Metabolite All-trans-Retinyl-Esters ==
 
* common-name:
 
* common-name:
** thiamine diphosphate
+
** an all-trans-retinyl ester
* molecular-weight:
 
** 422.288
 
* inchi-key:
 
** ayekofbpnlcajy-uhfffaoysa-l
 
* smiles:
 
** cc1([n+](=csc(ccop([o-])(=o)op([o-])(=o)[o-])=1)cc2(c=nc(c)=nc(n)=2))
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12583]]
+
* [[RXN-12575]]
* [[RXN0-3542]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12508]]
 
* [[RXN0-3542]]
 
* [[THIAMIN-PYROPHOSPHOKINASE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=thiamine diphosphate}}
+
{{#set: common-name=an all-trans-retinyl ester}}
{{#set: molecular-weight=422.288}}
 
{{#set: inchi-key=inchikey=ayekofbpnlcajy-uhfffaoysa-l}}
 

Revision as of 19:04, 17 March 2021

Metabolite All-trans-Retinyl-Esters

  • common-name:
    • an all-trans-retinyl ester

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality