Difference between revisions of "SINAPYL-ALCOHOL"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DETHIOBIOTIN == * common-name: ** dethiobiotin * molecular-weight: ** 213.256 * inchi-key: ** autolbmxddtrrt-uhfffaoysa-m * smiles: ** cc...") |
(Created page with "Category:metabolite == Metabolite SINAPYL-ALCOHOL == * common-name: ** sinapyl alcohol * molecular-weight: ** 210.229 * inchi-key: ** lzfopexouvtgjs-onegzznksa-n * smiles:...") |
||
| (3 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite SINAPYL-ALCOHOL == |
* common-name: | * common-name: | ||
| − | ** | + | ** sinapyl alcohol |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 210.229 |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** lzfopexouvtgjs-onegzznksa-n |
* smiles: | * smiles: | ||
| − | ** | + | ** coc1(c=c(c=cco)c=c(oc)c(o)=1) |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-1125]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=sinapyl alcohol}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=210.229}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=lzfopexouvtgjs-onegzznksa-n}} |
Latest revision as of 19:32, 17 March 2021
Contents
Metabolite SINAPYL-ALCOHOL
- common-name:
- sinapyl alcohol
- molecular-weight:
- 210.229
- inchi-key:
- lzfopexouvtgjs-onegzznksa-n
- smiles:
- coc1(c=c(c=cco)c=c(oc)c(o)=1)
