Difference between revisions of "ARG-tRNAs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-444 == * common-name: ** s-methyl-5-thio-α-d-ribose 1-phosphate * molecular-weight: ** 258.182 * inchi-key: ** jtfittqbrjdstl-k...")
(Created page with "Category:metabolite == Metabolite ARG-tRNAs == * common-name: ** a trnaarg == Reaction(s) known to consume the compound == * ARGININE--TRNA-LIGASE-RXN == Reaction(s) k...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-444 ==
+
== Metabolite ARG-tRNAs ==
 
* common-name:
 
* common-name:
** s-methyl-5-thio-α-d-ribose 1-phosphate
+
** a trnaarg
* molecular-weight:
 
** 258.182
 
* inchi-key:
 
** jtfittqbrjdstl-kvtdhhqdsa-l
 
* smiles:
 
** cscc1(oc(op([o-])(=o)[o-])c(c1o)o)
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[5.3.1.23-RXN]]
+
* [[ARGININE--TRNA-LIGASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[5-METHYLTHIORIBOSE-KINASE-RXN]]
+
* [[ARGINYLTRANSFERASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=s-methyl-5-thio-α-d-ribose 1-phosphate}}
+
{{#set: common-name=a trnaarg}}
{{#set: molecular-weight=258.182}}
 
{{#set: inchi-key=inchikey=jtfittqbrjdstl-kvtdhhqdsa-l}}
 

Latest revision as of 19:32, 17 March 2021

Metabolite ARG-tRNAs

  • common-name:
    • a trnaarg

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality