Difference between revisions of "D-GLUCARATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17383 == * common-name: ** (2e,9z,12z,15z,18z,21z)-tetracosahexaenoyl-coa * molecular-weight: ** 1102.034 * inchi-key: ** mmzjvinjfsr...")
 
(Created page with "Category:metabolite == Metabolite D-GLUCARATE == * common-name: ** d-glucarate * molecular-weight: ** 208.124 * inchi-key: ** dslzvsrjtyrbfb-lleiaeiesa-l * smiles: ** c(=o...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-17383 ==
+
== Metabolite D-GLUCARATE ==
 
* common-name:
 
* common-name:
** (2e,9z,12z,15z,18z,21z)-tetracosahexaenoyl-coa
+
** d-glucarate
 
* molecular-weight:
 
* molecular-weight:
** 1102.034
+
** 208.124
 
* inchi-key:
 
* inchi-key:
** mmzjvinjfsrjok-cynjbpnesa-j
+
** dslzvsrjtyrbfb-lleiaeiesa-l
 
* smiles:
 
* smiles:
** ccc=ccc=ccc=ccc=ccc=ccccccc=cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
+
** c(=o)(c(o)c(o)c(o)c(o)c(=o)[o-])[o-]
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16131]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16130]]
+
* [[RXN-14225]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(2e,9z,12z,15z,18z,21z)-tetracosahexaenoyl-coa}}
+
{{#set: common-name=d-glucarate}}
{{#set: molecular-weight=1102.034}}
+
{{#set: molecular-weight=208.124}}
{{#set: inchi-key=inchikey=mmzjvinjfsrjok-cynjbpnesa-j}}
+
{{#set: inchi-key=inchikey=dslzvsrjtyrbfb-lleiaeiesa-l}}

Latest revision as of 19:32, 17 March 2021

Metabolite D-GLUCARATE

  • common-name:
    • d-glucarate
  • molecular-weight:
    • 208.124
  • inchi-key:
    • dslzvsrjtyrbfb-lleiaeiesa-l
  • smiles:
    • c(=o)(c(o)c(o)c(o)c(o)c(=o)[o-])[o-]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality