Difference between revisions of "Protein-S-farnesyl-L-cysteines"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CAMP == * common-name: ** cyclic-amp * molecular-weight: ** 328.201 * inchi-key: ** ivomouwhdpkrll-kqynxxcusa-m * smiles: ** c3(op(=o)([o...")
(Created page with "Category:metabolite == Metabolite Protein-S-farnesyl-L-cysteines == * common_name: ** a [protein] s-farnesyl-l-cysteine == Reaction(s) known to consume the compound == * [...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CAMP ==
+
== Metabolite Protein-S-farnesyl-L-cysteines ==
* common-name:
+
* common_name:
** cyclic-amp
+
** a [protein] s-farnesyl-l-cysteine
* molecular-weight:
 
** 328.201
 
* inchi-key:
 
** ivomouwhdpkrll-kqynxxcusa-m
 
* smiles:
 
** c3(op(=o)([o-])oc4(c(o)c(n2(c1(=c(c(=nc=n1)n)n=c2)))oc34))
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN0-5038]]
+
* [[2.5.1.58-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[2.5.1.58-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=cyclic-amp}}
+
{{#set: common_name=a [protein] s-farnesyl-l-cysteine}}
{{#set: molecular-weight=328.201}}
 
{{#set: inchi-key=inchikey=ivomouwhdpkrll-kqynxxcusa-m}}
 

Latest revision as of 19:32, 17 March 2021

Metabolite Protein-S-farnesyl-L-cysteines

  • common_name:
    • a [protein] s-farnesyl-l-cysteine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common name" (as page type) with input value "a [protein] s-farnesyl-l-cysteine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.