Difference between revisions of "Long-chain-alcohols"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11552 == * common-name: ** 4-(2-amino-3-hydroxyphenyl)-2,4-dioxobutanoate * molecular-weight: ** 222.177 * inchi-key: ** ycjnyhccoxvy...")
 
(Created page with "Category:metabolite == Metabolite Long-chain-alcohols == * common-name: ** a long-chain alcohol == Reaction(s) known to consume the compound == * ALKYLGLYCERONE-PHOSPHAT...")
 
(3 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-11552 ==
+
== Metabolite Long-chain-alcohols ==
 
* common-name:
 
* common-name:
** 4-(2-amino-3-hydroxyphenyl)-2,4-dioxobutanoate
+
** a long-chain alcohol
* molecular-weight:
 
** 222.177
 
* inchi-key:
 
** ycjnyhccoxvyaf-uhfffaoysa-m
 
* smiles:
 
** c(=o)([o-])c(=o)cc(=o)c1(c=cc=c(o)c(n)=1)
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10721]]
+
* [[ALKYLGLYCERONE-PHOSPHATE-SYNTHASE-RXN]]
* [[RXN-10722]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10721]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=4-(2-amino-3-hydroxyphenyl)-2,4-dioxobutanoate}}
+
{{#set: common-name=a long-chain alcohol}}
{{#set: molecular-weight=222.177}}
 
{{#set: inchi-key=inchikey=ycjnyhccoxvyaf-uhfffaoysa-m}}
 

Latest revision as of 19:33, 17 March 2021

Metabolite Long-chain-alcohols

  • common-name:
    • a long-chain alcohol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality