Difference between revisions of "P-RIBOSYL-4-SUCCCARB-AMINOIMIDAZOLE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-466 == * common-name: ** (s)-3-amino-2-methylpropanoate * molecular-weight: ** 103.121 * inchi-key: ** qchpksfmdhpsnr-vkhmyheasa-n *...")
(Created page with "Category:metabolite == Metabolite P-RIBOSYL-4-SUCCCARB-AMINOIMIDAZOLE == * common-name: ** 5'-phosphoribosyl-4-(n-succinocarboxamide)-5-aminoimidazole * molecular-weight:...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-466 ==
+
== Metabolite P-RIBOSYL-4-SUCCCARB-AMINOIMIDAZOLE ==
 
* common-name:
 
* common-name:
** (s)-3-amino-2-methylpropanoate
+
** 5'-phosphoribosyl-4-(n-succinocarboxamide)-5-aminoimidazole
 
* molecular-weight:
 
* molecular-weight:
** 103.121
+
** 450.255
 
* inchi-key:
 
* inchi-key:
** qchpksfmdhpsnr-vkhmyheasa-n
+
** naqghjtuzrhgac-lbgugvgysa-j
 
* smiles:
 
* smiles:
** cc(c[n+])c([o-])=o
+
** c(op([o-])([o-])=o)c2(c(o)c(o)c(n1(c(n)=c(c(=o)nc(c([o-])=o)cc([o-])=o)n=c1))o2)
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.6.1.22-RXN]]
+
* [[AICARSYN-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.6.1.22-RXN]]
+
* [[AICARSYN-RXN]]
 +
* [[SAICARSYN-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(s)-3-amino-2-methylpropanoate}}
+
{{#set: common-name=5'-phosphoribosyl-4-(n-succinocarboxamide)-5-aminoimidazole}}
{{#set: molecular-weight=103.121}}
+
{{#set: molecular-weight=450.255}}
{{#set: inchi-key=inchikey=qchpksfmdhpsnr-vkhmyheasa-n}}
+
{{#set: inchi-key=inchikey=naqghjtuzrhgac-lbgugvgysa-j}}

Latest revision as of 19:33, 17 March 2021

Metabolite P-RIBOSYL-4-SUCCCARB-AMINOIMIDAZOLE

  • common-name:
    • 5'-phosphoribosyl-4-(n-succinocarboxamide)-5-aminoimidazole
  • molecular-weight:
    • 450.255
  • inchi-key:
    • naqghjtuzrhgac-lbgugvgysa-j
  • smiles:
    • c(op([o-])([o-])=o)c2(c(o)c(o)c(n1(c(n)=c(c(=o)nc(c([o-])=o)cc([o-])=o)n=c1))o2)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality