Difference between revisions of "CIT"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-3 == * common-name: ** molybdate * molecular-weight: ** 159.938 * inchi-key: ** mefbjemvzonfcj-uhfffaoysa-n * smiles: ** [mo](=o)(=o)...") |
(Created page with "Category:metabolite == Metabolite CIT == * common-name: ** citrate * molecular-weight: ** 189.101 * inchi-key: ** krknybchxyngox-uhfffaoysa-k * smiles: ** c(=o)([o-])cc(c(...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CIT == |
* common-name: | * common-name: | ||
| − | ** | + | ** citrate |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 189.101 |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** krknybchxyngox-uhfffaoysa-k |
* smiles: | * smiles: | ||
| − | ** | + | ** c(=o)([o-])cc(c(=o)[o-])(o)cc(=o)[o-] |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[ACONITATEDEHYDR-RXN]] |
| − | * [[RXN- | + | * [[ATP-CITRATE-PRO-S--LYASE-RXN]] |
| − | * [[ | + | * [[RXN-14047]] |
| + | * [[biomass_rxn]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[ACONITATEDEHYDR-RXN]] |
| − | * [[ | + | * [[CITSYN-RXN]] |
| + | * [[RXN-14047]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=citrate}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=189.101}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=krknybchxyngox-uhfffaoysa-k}} |
Latest revision as of 19:33, 17 March 2021
Contents
Metabolite CIT
- common-name:
- citrate
- molecular-weight:
- 189.101
- inchi-key:
- krknybchxyngox-uhfffaoysa-k
- smiles:
- c(=o)([o-])cc(c(=o)[o-])(o)cc(=o)[o-]
