Difference between revisions of "METOH"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite GERANYL-PP == * common-name: ** geranyl diphosphate * molecular-weight: ** 311.188 * inchi-key: ** gvvpgtzrzfnkds-jxmrogbwsa-k * smiles:...")
(Created page with "Category:metabolite == Metabolite METOH == * common-name: ** methanol * molecular-weight: ** 32.042 * inchi-key: ** okkjlvbelutlkv-uhfffaoysa-n * smiles: ** co == Reaction...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite GERANYL-PP ==
+
== Metabolite METOH ==
 
* common-name:
 
* common-name:
** geranyl diphosphate
+
** methanol
 
* molecular-weight:
 
* molecular-weight:
** 311.188
+
** 32.042
 
* inchi-key:
 
* inchi-key:
** gvvpgtzrzfnkds-jxmrogbwsa-k
+
** okkjlvbelutlkv-uhfffaoysa-n
 
* smiles:
 
* smiles:
** cc(=cccc(=ccop([o-])(op(=o)([o-])[o-])=o)c)c
+
** co
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-5109]]
+
* [[RXN-14189]]
* [[RXN-5110]]
 
* [[TRANS-OCTAPRENYLTRANSTRANSFERASE-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[GPPSYN-RXN]]
+
* [[RXN-10711]]
 +
* [[RXN-10767]]
 +
* [[RXNQT-4366]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=geranyl diphosphate}}
+
{{#set: common-name=methanol}}
{{#set: molecular-weight=311.188}}
+
{{#set: molecular-weight=32.042}}
{{#set: inchi-key=inchikey=gvvpgtzrzfnkds-jxmrogbwsa-k}}
+
{{#set: inchi-key=inchikey=okkjlvbelutlkv-uhfffaoysa-n}}

Latest revision as of 19:33, 17 March 2021

Metabolite METOH

  • common-name:
    • methanol
  • molecular-weight:
    • 32.042
  • inchi-key:
    • okkjlvbelutlkv-uhfffaoysa-n
  • smiles:
    • co

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality