Difference between revisions of "Protein-Ox-Disulfides"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-10269 == * common-name: ** palmitoleoyl-coa * molecular-weight: ** 999.899 * inchi-key: ** qbyoccwnzaoztl-mdmkaecgsa-j * smiles: ** c...")
(Created page with "Category:metabolite == Metabolite Protein-Ox-Disulfides == * common-name: ** a protein with a disulfide bond == Reaction(s) known to consume the compound == == Reaction(s)...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-10269 ==
+
== Metabolite Protein-Ox-Disulfides ==
 
* common-name:
 
* common-name:
** palmitoleoyl-coa
+
** a protein with a disulfide bond
* molecular-weight:
 
** 999.899
 
* inchi-key:
 
** qbyoccwnzaoztl-mdmkaecgsa-j
 
* smiles:
 
** ccccccc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10662]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10664]]
+
* [[DISULFOXRED-RXN]]
* [[RXN-17787]]
 
* [[RXN0-7248]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=palmitoleoyl-coa}}
+
{{#set: common-name=a protein with a disulfide bond}}
{{#set: molecular-weight=999.899}}
 
{{#set: inchi-key=inchikey=qbyoccwnzaoztl-mdmkaecgsa-j}}
 

Latest revision as of 19:33, 17 March 2021

Metabolite Protein-Ox-Disulfides

  • common-name:
    • a protein with a disulfide bond

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality