Difference between revisions of "Protein-L-Ser-or-L-Thr-L-Pro"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD0-2231 == * common-name: ** didp * molecular-weight: ** 409.165 * inchi-key: ** bkusikgspsfqac-rrkcrqdmsa-k * smiles: ** c(op(=o)([o-]...")
(Created page with "Category:metabolite == Metabolite Protein-L-Ser-or-L-Thr-L-Pro == * common-name: ** a protein containing an (l-serine/l-threonine)-l-proline motif == Reaction(s) known to...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite CPD0-2231 ==
+
== Metabolite Protein-L-Ser-or-L-Thr-L-Pro ==
 
* common-name:
 
* common-name:
−
** didp
+
** a protein containing an (l-serine/l-threonine)-l-proline motif
−
* molecular-weight:
 
−
** 409.165
 
−
* inchi-key:
 
−
** bkusikgspsfqac-rrkcrqdmsa-k
 
−
* smiles:
 
−
** c(op(=o)([o-])op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c=nc2(c(=o)nc=nc=23)))
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN-14228]]
+
* [[2.7.11.24-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN-14228]]
+
* [[2.7.11.24-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=didp}}
+
{{#set: common-name=a protein containing an (l-serine/l-threonine)-l-proline motif}}
−
{{#set: molecular-weight=409.165}}
 
−
{{#set: inchi-key=inchikey=bkusikgspsfqac-rrkcrqdmsa-k}}
 

Latest revision as of 19:33, 17 March 2021

Metabolite Protein-L-Ser-or-L-Thr-L-Pro

  • common-name:
    • a protein containing an (l-serine/l-threonine)-l-proline motif

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "http://gem-aureme.genouest.org//esubgem/index.php?title=Protein-L-Ser-or-L-Thr-L-Pro&oldid=48424"