Difference between revisions of "FRUCTOSE-16-DIPHOSPHATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Glucopyranose == * common-name: ** d-glucopyranose == Reaction(s) known to consume the compound == * GLUCOKIN-RXN == Reaction(s) know...")
 
(Created page with "Category:metabolite == Metabolite FRUCTOSE-16-DIPHOSPHATE == * common-name: ** β-d-fructose 1,6-bisphosphate * molecular-weight: ** 336.085 * inchi-key: ** rnbgygvwrk...")
 
(3 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Glucopyranose ==
+
== Metabolite FRUCTOSE-16-DIPHOSPHATE ==
 
* common-name:
 
* common-name:
** d-glucopyranose
+
** β-d-fructose 1,6-bisphosphate
 +
* molecular-weight:
 +
** 336.085
 +
* inchi-key:
 +
** rnbgygvwrkecfj-arqdhwqxsa-j
 +
* smiles:
 +
** c(c1(c(c(c(o1)(cop(=o)([o-])[o-])o)o)o))op([o-])(=o)[o-]
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[GLUCOKIN-RXN]]
+
* [[2.7.1.90-RXN]]
 +
* [[F16ALDOLASE-RXN]]
 +
* [[F16BDEPHOS-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[3.2.1.39-RXN]]
+
* [[2.7.1.90-RXN]]
* [[ALPHAGALACTOSID-RXN]]
+
* [[6PFRUCTPHOS-RXN]]
* [[AMYGDALIN-BETA-GLUCOSIDASE-RXN]]
+
* [[F16ALDOLASE-RXN]]
* [[BETAGALACTOSID-RXN]]
 
* [[GLUCOSE-1-PHOSPHAT-RXN]]
 
* [[KETOLACTOSE-RXN]]
 
* [[RXN-10773]]
 
* [[RXN-15910]]
 
* [[RXN-8036]]
 
* [[RXN66-526]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=d-glucopyranose}}
+
{{#set: common-name=β-d-fructose 1,6-bisphosphate}}
 +
{{#set: molecular-weight=336.085}}
 +
{{#set: inchi-key=inchikey=rnbgygvwrkecfj-arqdhwqxsa-j}}

Latest revision as of 19:33, 17 March 2021

Metabolite FRUCTOSE-16-DIPHOSPHATE

  • common-name:
    • β-d-fructose 1,6-bisphosphate
  • molecular-weight:
    • 336.085
  • inchi-key:
    • rnbgygvwrkecfj-arqdhwqxsa-j
  • smiles:
    • c(c1(c(c(c(o1)(cop(=o)([o-])[o-])o)o)o))op([o-])(=o)[o-]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality