Difference between revisions of "DNA-Guanines"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 2K-ADIPATE == * common-name: ** 2-oxoadipate * molecular-weight: ** 158.11 * inchi-key: ** fgsbnbbhozhubo-uhfffaoysa-l * smiles: ** c(cc(...")
(Created page with "Category:metabolite == Metabolite DNA-Guanines == * common-name: ** a guanine in dna == Reaction(s) known to consume the compound == == Reaction(s) known to produce the co...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 2K-ADIPATE ==
+
== Metabolite DNA-Guanines ==
 
* common-name:
 
* common-name:
** 2-oxoadipate
+
** a guanine in dna
* molecular-weight:
 
** 158.11
 
* inchi-key:
 
** fgsbnbbhozhubo-uhfffaoysa-l
 
* smiles:
 
** c(cc(=o)c(=o)[o-])cc(=o)[o-]
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2-KETO-ADIPATE-DEHYDROG-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[2.1.1.63-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-oxoadipate}}
+
{{#set: common-name=a guanine in dna}}
{{#set: molecular-weight=158.11}}
 
{{#set: inchi-key=inchikey=fgsbnbbhozhubo-uhfffaoysa-l}}
 

Latest revision as of 19:33, 17 March 2021

Metabolite DNA-Guanines

  • common-name:
    • a guanine in dna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality