Difference between revisions of "Oxidized-adrenal-ferredoxins"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8652 == * common-name: ** leucodopachrome * molecular-weight: ** 194.166 * inchi-key: ** jdwyrsddjvcwpb-lurjtmiesa-m * smiles: ** c([...")
(Created page with "Category:metabolite == Metabolite Oxidized-adrenal-ferredoxins == * common-name: ** an oxidized adrenodoxin == Reaction(s) known to consume the compound == * RXN-13685...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-8652 ==
+
== Metabolite Oxidized-adrenal-ferredoxins ==
 
* common-name:
 
* common-name:
** leucodopachrome
+
** an oxidized adrenodoxin
* molecular-weight:
 
** 194.166
 
* inchi-key:
 
** jdwyrsddjvcwpb-lurjtmiesa-m
 
* smiles:
 
** c([o-])(=o)c1(nc2(=c(c1)c=c(o)c(o)=c2))
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-11369]]
+
* [[RXN-13685]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-8483]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=leucodopachrome}}
+
{{#set: common-name=an oxidized adrenodoxin}}
{{#set: molecular-weight=194.166}}
 
{{#set: inchi-key=inchikey=jdwyrsddjvcwpb-lurjtmiesa-m}}
 

Latest revision as of 19:33, 17 March 2021

Metabolite Oxidized-adrenal-ferredoxins

  • common-name:
    • an oxidized adrenodoxin

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality