Difference between revisions of "Carboxybiotin-BCCP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11529 == * common-name: ** (+)-7-epi-jasmonoyl-coa * molecular-weight: ** 955.76 * inchi-key: ** wqkkcppndksaiu-cbgydujusa-j * smiles...")
(Created page with "Category:metabolite == Metabolite Carboxybiotin-BCCP == * common_name: ** a carboxylated-biotinylated [bccp dimer] == Reaction(s) known to consume the compound == * RXN0...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-11529 ==
+
== Metabolite Carboxybiotin-BCCP ==
* common-name:
+
* common_name:
** (+)-7-epi-jasmonoyl-coa
+
** a carboxylated-biotinylated [bccp dimer]
* molecular-weight:
 
** 955.76
 
* inchi-key:
 
** wqkkcppndksaiu-cbgydujusa-j
 
* smiles:
 
** ccc=ccc1(c(=o)ccc1cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-])=o)
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10708]]
+
* [[RXN0-5055]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10701]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(+)-7-epi-jasmonoyl-coa}}
+
{{#set: common_name=a carboxylated-biotinylated [bccp dimer]}}
{{#set: molecular-weight=955.76}}
 
{{#set: inchi-key=inchikey=wqkkcppndksaiu-cbgydujusa-j}}
 

Latest revision as of 19:33, 17 March 2021

Metabolite Carboxybiotin-BCCP

  • common_name:
    • a carboxylated-biotinylated [bccp dimer]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common name" (as page type) with input value "a carboxylated-biotinylated [bccp dimer" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.