Difference between revisions of "OH-ACYL-ACP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11519 == * common-name: ** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3r-hydroxyoctanoyl)-coa * molecular-weight: ** 1055.92 * inchi-k...")
 
(Created page with "Category:metabolite == Metabolite OH-ACYL-ACP == * common-name: ** a (3r)-3-hydroxyacyl-[acyl-carrier protein] == Reaction(s) known to consume the compound == * 3-HYDROX...")
 
(3 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-11519 ==
+
== Metabolite OH-ACYL-ACP ==
 
* common-name:
 
* common-name:
** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3r-hydroxyoctanoyl)-coa
+
** a (3r)-3-hydroxyacyl-[acyl-carrier protein]
* molecular-weight:
 
** 1055.92
 
* inchi-key:
 
** pddhcvxpabqiso-xjjfhseksa-j
 
* smiles:
 
** ccc=ccc1(c(ccc(=o)1)cccccc(o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-])=o)
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10698]]
+
* [[3-HYDROXYDECANOYL-ACP-DEHYDR-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10697]]
+
* [[3-OXOACYL-ACP-REDUCT-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3r-hydroxyoctanoyl)-coa}}
+
{{#set: common-name=a (3r)-3-hydroxyacyl-[acyl-carrier protein]}}
{{#set: molecular-weight=1055.92}}
 
{{#set: inchi-key=inchikey=pddhcvxpabqiso-xjjfhseksa-j}}
 

Latest revision as of 19:33, 17 March 2021

Metabolite OH-ACYL-ACP

  • common-name:
    • a (3r)-3-hydroxyacyl-[acyl-carrier protein]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a (3r)-3-hydroxyacyl-[acyl-carrier protein" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.