Difference between revisions of "Trans-D2-cis-cis-D17-35-C54-3-ACPs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite BILIVERDINE == * common-name: ** (z,z)-biliverdin-ix α * molecular-weight: ** 580.639 * inchi-key: ** qbuvfdktzjnupp-bbroenkcsa-l *...")
(Created page with "Category:metabolite == Metabolite trans-D2-cis-cis-D17-35-C54-3-ACPs == * common_name: ** a trans-delta2-cis,cis-delta17,35-c54:3-[acp] == Reaction(s) known to consume the...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite BILIVERDINE ==
+
== Metabolite trans-D2-cis-cis-D17-35-C54-3-ACPs ==
* common-name:
+
* common_name:
** (z,z)-biliverdin-ix α
+
** a trans-delta2-cis,cis-delta17,35-c54:3-[acp]
* molecular-weight:
 
** 580.639
 
* inchi-key:
 
** qbuvfdktzjnupp-bbroenkcsa-l
 
* smiles:
 
** c=cc1(=c(c)c(nc1=cc4(=c(c)c(ccc(=o)[o-])=c(c=c2(c(ccc(=o)[o-])=c(c)c(=n2)c=c3(c(c)=c(c=c)c(=o)n3)))n4))=o)
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[1.3.7.4-RXN]]
 
* [[BILIVERDIN-REDUCTASE-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[HEME-OXYGENASE-DECYCLIZING-RXN]]
+
* [[RXN1G-220]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(z,z)-biliverdin-ix α}}
+
{{#set: common_name=a trans-delta2-cis,cis-delta17,35-c54:3-[acp]}}
{{#set: molecular-weight=580.639}}
 
{{#set: inchi-key=inchikey=qbuvfdktzjnupp-bbroenkcsa-l}}
 

Latest revision as of 19:33, 17 March 2021

Metabolite trans-D2-cis-cis-D17-35-C54-3-ACPs

  • common_name:
    • a trans-delta2-cis,cis-delta17,35-c54:3-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common name" (as page type) with input value "a trans-delta2-cis,cis-delta17,35-c54:3-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.