Difference between revisions of "GLYCOLLATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17815 == * common-name: ** (11z)-3-oxo-hexadecenoyl-coa * molecular-weight: ** 1013.883 * inchi-key: ** lgtvdwicxibioi-ubpkjmqesa-j *...")
 
(Created page with "Category:metabolite == Metabolite GLYCOLLATE == * common-name: ** glycolate * molecular-weight: ** 75.044 * inchi-key: ** aemrfaofkbgasw-uhfffaoysa-m * smiles: ** c(c(=o)[...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-17815 ==
+
== Metabolite GLYCOLLATE ==
 
* common-name:
 
* common-name:
** (11z)-3-oxo-hexadecenoyl-coa
+
** glycolate
 
* molecular-weight:
 
* molecular-weight:
** 1013.883
+
** 75.044
 
* inchi-key:
 
* inchi-key:
** lgtvdwicxibioi-ubpkjmqesa-j
+
** aemrfaofkbgasw-uhfffaoysa-m
 
* smiles:
 
* smiles:
** ccccc=ccccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** c(c(=o)[o-])o
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16559]]
+
* [[RXN-969]]
* [[RXN-16561]]
+
* [[biomass_rxn]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16559]]
+
* [[GLYOXYLATE-REDUCTASE-NADP+-RXN]]
 +
* [[GPH-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(11z)-3-oxo-hexadecenoyl-coa}}
+
{{#set: common-name=glycolate}}
{{#set: molecular-weight=1013.883}}
+
{{#set: molecular-weight=75.044}}
{{#set: inchi-key=inchikey=lgtvdwicxibioi-ubpkjmqesa-j}}
+
{{#set: inchi-key=inchikey=aemrfaofkbgasw-uhfffaoysa-m}}

Latest revision as of 19:33, 17 March 2021

Metabolite GLYCOLLATE

  • common-name:
    • glycolate
  • molecular-weight:
    • 75.044
  • inchi-key:
    • aemrfaofkbgasw-uhfffaoysa-m
  • smiles:
    • c(c(=o)[o-])o

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality