Difference between revisions of "D-Galactosyl-12-diacyl-glycerols"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite L-1-LYSOPHOSPHATIDATE == * common-name: ** 1-oleoyl-sn-glycerol 3-phosphate * molecular-weight: ** 434.509 * inchi-key: ** wrgqswvcfniunz...")
(Created page with "Category:metabolite == Metabolite D-Galactosyl-12-diacyl-glycerols == * common-name: ** a 1,2-diacyl-3-o-(β-d-galactopyranosyl)-sn-glycerol == Reaction(s) known to co...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite L-1-LYSOPHOSPHATIDATE ==
+
== Metabolite D-Galactosyl-12-diacyl-glycerols ==
 
* common-name:
 
* common-name:
** 1-oleoyl-sn-glycerol 3-phosphate
+
** a 1,2-diacyl-3-o-(β-d-galactopyranosyl)-sn-glycerol
* molecular-weight:
 
** 434.509
 
* inchi-key:
 
** wrgqswvcfniunz-gdckjwnlsa-l
 
* smiles:
 
** ccccccccc=ccccccccc(=o)occ(cop([o-])([o-])=o)o
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-15043]]
+
* [[RXN-1225]]
 +
* [[RXN-1226]]
 +
* [[RXN-16634]]
 +
* [[RXN-16635]]
 +
* [[RXN-9721]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-15045]]
+
* [[2.4.1.46-RXN]]
* [[RXN-15046]]
+
* [[RXN-16634]]
* [[RXN-15068]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-oleoyl-sn-glycerol 3-phosphate}}
+
{{#set: common-name=a 1,2-diacyl-3-o-(β-d-galactopyranosyl)-sn-glycerol}}
{{#set: molecular-weight=434.509}}
 
{{#set: inchi-key=inchikey=wrgqswvcfniunz-gdckjwnlsa-l}}
 

Latest revision as of 19:33, 17 March 2021

Metabolite D-Galactosyl-12-diacyl-glycerols

  • common-name:
    • a 1,2-diacyl-3-o-(β-d-galactopyranosyl)-sn-glycerol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality